| Identification | |
| Name: | isopropyl isocyanate |
| Synonyms: | Isocyanic acid isopropyl ester |
| CAS: | 1795-48-8 |
| EINECS: | 217-276-5 |
| Molecular Formula: | C4H7NO |
| Molecular Weight: | 85.1 |
| InChI: | InChI=1/C4H7NO/c1-4(2)5-3-6/h4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2483 |
| Density: | 0.868 |
| Stability: | No data. |
| Refractive index: | 1.382 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | A colorless liquid with a pungent odor. |
| Packinggroup: | I |
| Sensitive: | Moisture Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
