| Identification | |
| Name: | 1,8-Naphthyridine,3-bromo- |
| Synonyms: | 3-Bromo-1,7-naphthyridine;3-Bromo-1,8-naphthyridine; |
| CAS: | 17965-78-5 |
| Molecular Formula: | C8H5BrN2 |
| Molecular Weight: | 209.04 |
| InChI: | InChI=1/C8H5BrN2/c9-7-4-6-2-1-3-10-8(6)11-5-7/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 164-166 ºC |
| Flash Point: | 129 ºC |
| Boiling Point: | 289 ºC |
| Density: | 1.656 |
| Refractive index: | 1.685 |
| Specification: |
The systematic name od this product is 3-bromo-1,8-naphthyridine . With the CAS registry number 17965-78-5, it is also named as 1,8-naphthyridine, 3-bromo- ; 3-Bromo[1,8]naphthyridine ; 3-Bromo-[1,8]naphthyridine . The other characteristics of this product can be summarized as: (1) #H bond acceptors: 2; (2) #H bond donors: 0; (3) Index of Refraction: 1.685; (4) Molar Refractivity: 47.93 cm3; (5) Molar Volume: 126.1 cm3; (6) Polarizability: 19.01×10-24 cm3; (7) Surface Tension: 59.1 dyne/cm; (8) Enthalpy of Vaporization: 50.75 kJ/mol; (9) Vapour Pressure: 0.00384 mmHg at 25 °C. People can use the following data to convert to the molecule structure. SMILES: Brc2cc1c(nccc1)nc2; InChI: InChI=1/C8H5BrN2/c9-7-4-6-2-1-3-10-8(6)11-5-7/h1-5H. This product has many suppliers in the market, such as Epochem Co., Ltd. |
| Flash Point: | 129 ºC |
| Safety Data | |
 |
|
