| Identification | |
| Name: | Pyridine,2-[(2-chloro-4-nitrophenoxy)methyl]- |
| Synonyms: | 2-[(2-Chloro-4-nitrophenoxy)methyl]pyridine;3-Chloro-4-(2-pyridinylmethoxy)-1-nitrobenzene;3-Chloro-4-(2-pyridylmethyloxy)nitrobenzene;3-Chloro-4-[(2-pyridyl)methoxy]nitrobenzene; |
| CAS: | 179687-79-7 |
| Molecular Formula: | C12H9ClN2O3 |
| Molecular Weight: | 264.66 |
| InChI: | InChI=1/C12H9ClN2O3/c13-11-7-10(15(16)17)4-5-12(11)18-8-9-3-1-2-6-14-9/h1-7H,8H2 |
| Molecular Structure: | ![(C12H9ClN2O3) 2-[(2-Chloro-4-nitrophenoxy)methyl]pyridine;3-Chloro-4-(2-pyridinylmethoxy)-1-nitrobenzene;3-Chloro-...](https://img.guidechem.com/casimg/179687-79-7.gif) |
| Properties | |
| Melting Point: | 125-129 ºC |
| Density: | 1.385g/cm3 |
| Refractive index: | 1.618 |
| Specification: |
The 2-[(2-Chloro-4-nitrophenoxy)methyl]pyridine, with CAS registry number 179687-79-7, has the systematic name of 2-[(2-chloro-4-nitrophenoxy)methyl]pyridine. Besides this, it is also called pyridine, 2-[(2-chloro-4-nitrophenoxy)methyl]-. And the chemical formula of this chemical is C12H9ClN2O3. Physical properties about this chemical are: (1)ACD/LogP: 2.95; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 83; (6)ACD/BCF (pH 7.4): 84; (7)ACD/KOC (pH 5.5): 820; (8)ACD/KOC (pH 7.4): 828; (9)#H bond acceptors: 5; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 67.94 Å2; (13)Index of Refraction: 1.618; (14)Molar Refractivity: 66.951 cm3; (15)Molar Volume: 191.154 cm3; (16)Polarizability: 26.541×10-24cm3; (17)Surface Tension: 55.435 dyne/cm; (18)Enthalpy of Vaporization: 64.179 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
