| Identification | |
| Name: | 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone |
| Synonyms: | 6,7-bis-(2-Methoxyethoxy)quinazolin-4(3h)-one;4(1H)-Quinazolinone,6,7-bis(2-methoxyethoxy)- (9CI);6,7-Bis(2-methoxyethoxy)-3,4-dihydroquinazolin-4-one;6,7-Bis(2-methoxyethoxy)quinazolin-4(3H)-one;6,7-Di(2-methoxyethoxy)-3,4-dihydroquinazolin-4-one;4(3H)-Quinazolinone,6,7-bis(2-methoxyethoxy)-; |
| CAS: | 179688-29-0 |
| Molecular Formula: | C14H18N2O5 |
| Molecular Weight: | 294.3 |
| InChI: | InChI=1/C14H18N2O5/c1-18-3-5-20-12-7-10-11(15-9-16-14(10)17)8-13(12)21-6-4-19-2/h7-9H,3-6H2,1-2H3,(H,15,16,17) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 185-189 oC |
| Flash Point: | 236.7 oC |
| Boiling Point: | 467.8 oCat 760 mmHg |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.552 |
| Appearance: | off-white solid |
| Specification: |
? 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone (CAS NO.179688-29-0), its Synonyms are 6,7-Bis(2-Methoxyethoxy)-3,4-dihydroquinazolin-4-one ; 6,7-Bis-(2-methoxyethoxy)quinazolin-4(3H)-one ; 6,7-Bis(2-methoxyethoxy)-quinazolin-4-one . It is off-white solid. |
| Flash Point: | 236.7 oC |
| Usage: | 6,7-Bis-(2-methoxyethoxy)-4(3H)-quinazolinone (CAS NO.179688-29-0) is used as an intermediate in the synthesis of erlotini. |
| Safety Data | |
 |
|
