| Identification | |
| Name: | Phosphonic acid,dibutyl ester |
| Synonyms: | Butylphosphite ((C4H9O)2(HO)P) (6CI,7CI); Butyl alcohol, hydrogen phosphite; Butylphosphonate ((BuO)2HPO); Butyl phosphonate ((C4H9O)2HPO); DBP 1; Di-n-butylhydrogen phosphite; Di-n-butyl phosphite; Dibutoxyphosphine oxide; Dibutylhydrogen phosphite; Dibutyl phosphite; Dibutyl phosphonate; NSC 2668;Phosphorous acid, dibutyl ester |
| CAS: | 1809-19-4 |
| EINECS: | 217-316-1 |
| Molecular Formula: | C8H19 O3 P |
| Molecular Weight: | 194.21 |
| InChI: | InChI=1/C8H19O3P/c1-3-5-7-10-12(9)11-8-6-4-2/h9H,3-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1760 |
| Density: | 0.995 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4225-1.4245 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | colorless |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | I; II; III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Flammables-area. Store protected from moisture. |
| Color: | Water-white liquid Oil |
| Usage: | Solvent, antioxidant, chemical intermediate. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
