| Identification | |
| Name: | Phosphonic acid,bis(1-methylethyl) ester |
| Synonyms: | Isopropylphosphonate ((C3H7O)2HPO) (6CI,7CI);Phosphonic acid, diisopropyl ester (8CI);Bis(2-propyl) phosphite;Diisopropoxyphosphine oxide;Diisopropyl hydrogenphosphite;Diisopropyl phosphite;Diisopropyl phosphonate;Isopropyl phosphite((C3H7O)2(HO)P);NSC 82344;O,O-Diisopropyl phosphonate; |
| CAS: | 1809-20-7 |
| EINECS: | 217-317-7 |
| Molecular Formula: | C6H15O3P |
| Molecular Weight: | 166.16 |
| InChI: | InChI=1/C6H15O3P/c1-5(2)8-10(7)9-6(3)4/h5-6,10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Density: | 0.997 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | 1.4065-1.4085 |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | clear, colorless clear liquid. |
| Specification: |
Diisopropyl phosphite (1809-20-7) also can be called Diisopropyl phosphonate ; Diisopropyl hydrogen phosphite ; Phosphinous acid, diisopropyl ester . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
