| Identification |
| Name: | Pyrazine,2,3-diethyl-5-methyl- |
| Synonyms: | 2,3-Diethyl-6-methylpyrazine;2-Methyl-5,6-diethylpyrazine;5-Methyl-2,3-diethylpyrazine; |
| CAS: | 18138-04-0 |
| EINECS: | 242-024-6 |
| Molecular Formula: | C9H14N2 |
| Molecular Weight: | 150.22 |
| InChI: | InChI=1/C9H14N2/c1-4-8-9(5-2)11-7(3)6-10-8/h6H,4-5H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Density: | 0.949 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.497-1.499 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble |
| Appearance: | clear to pale yellow liquid |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
