| Identification | |
| Name: | 4-Phenylbutyric acid |
| Synonyms: | Butyricacid, 4-phenyl- (8CI);Butyric acid, g-phenyl- (3CI);4-Phenyl-n-butyric acid;Benzenebutanoic acid;Benzenebutyric acid;NSC 295;g-Phenylbutanoic acid;g-Phenylbutyric acid;w-Phenylbutanoic acid; |
| CAS: | 1821-12-1 |
| EINECS: | 217-341-8 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 16510 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.489 (20 C) |
| Solubility: | 5.3 g/L at 40 oC |
| Appearance: | white to slightly yellowish crystalline powder |
| Specification: |
?4-Phenylbutyric acid (CAS NO.1821-12-1) is also named as 1-Phenylbutyric acid ; 4-Phenylbutyric acid ; AI3-12065 ; Benzenebutyric acid ; NSC 295 ; gamma-Phenylbutyric acid ; omega-Phenylbutanoic acid?.?4-Phenylbutyric acid (CAS NO.1821-12-1) is white to slightly yellowish crystalline powder. |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A chemical chaperone involved in protein-folding disorders. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
