| Identification | |
| Name: | Methyl 3-amino-4-methylbenzoate |
| Synonyms: | p-Toluicacid, 3-amino-, methyl ester (6CI,8CI);2-Methyl-5-methoxycarbonylaniline;3-Amino-4-methylbenzoic acid methyl ester;Benzoic acid,3-amino-4-methyl-, methyl ester;NSC356832; |
| CAS: | 18595-18-1 |
| Molecular Formula: | C9H11NO2 |
| Molecular Weight: | 165.19 |
| InChI: | InChI=1S/C9H11NO2/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5H,10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.132 g/cm3 |
| Appearance: | off-white crystalline powder |
| Specification: |
Methyl 3-amino-4-methylbenzoate , its cas register number 18595-18-1. It also can be called 3-Amino-4-methylbenzoic acid methylester ; and Benzoic acid, 3-amino-4-methyl-, methyl ester . It should be stored in a tightly closed container, or stored in a cool, dry place. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
