| Identification | |
| Name: | Anthracene,2,6-dibromo- |
| Synonyms: | 2,6-Dibromoanthracene; |
| CAS: | 186517-01-1 |
| Molecular Formula: | C14H8Br2 |
| Molecular Weight: | 336.02 |
| InChI: | InChI=1/C14H8Br2/c15-13-3-1-9-5-12-8-14(16)4-2-10(12)6-11(9)7-13/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.768 g/cm3 |
| Refractive index: | 1.749 |
| Specification: |
The 2,6-Dibromoanthracene with the CAS number 186517-01-1 is also called Anthracene,2,6-dibromo-. Its molecular formula is C14H8Br2. This chemical belongs to the following product categories: (1)Anthracenes; (2)Anthracene derivatives. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 6.06; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 6; (4)ACD/LogD (pH 7.4): 6; (5)ACD/BCF (pH 5.5): 31591; (6)ACD/BCF (pH 7.4): 31591; (7)ACD/KOC (pH 5.5): 57859; (8)ACD/KOC (pH 7.4): 57859; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 0 Å2; (13)Index of Refraction: 1.749; (14)Molar Refractivity: 77.318 cm3; (15)Molar Volume: 190.035 cm3; (16)Polarizability: 30.651×10-24cm3; (17)Surface Tension: 54.329 dyne/cm; (18)Enthalpy of Vaporization: 66.877 kJ/mol; (19)Vapour Pressure: 0 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
