| Identification |
| Name: | Quinoxaline,2,6-dichloro- |
| Synonyms: | - |
| CAS: | 18671-97-1 |
| Molecular Formula: | C8H4Cl2N2 |
| Molecular Weight: | 199.04 |
| InChI: | InChI=1/C8H4Cl2N2/c9-5-1-2-6-7(3-5)11-4-8(10)12-6/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.486 g/cm3 |
| Refractive index: | 1.67 |
| Solubility: | Insoluble in water, but soluble in benzene and toluene |
| Appearance: | Pale yellow to grey crystalline particle |
| Usage: | Intermediate for the production of herbicides Attributes For further information please contact us Contact |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |