| Identification |
| Name: | 2H-Tetrazolium,2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3,5-diphenyl-, chloride (1:2) |
| Synonyms: | 2H-Tetrazolium,2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3,5-diphenyl-, dichloride(9CI);2H-Tetrazolium,3,3'-(3,3'-dimethoxy-4,4'-biphenylylene)bis[2,5-diphenyl-, dichloride (8CI);3,3'-(3,3'-Dimethoxy-4,4'-biphenylylene)bis[2,5-diphenyl-2H-tetrazoliumchloride] (6CI,7CI);2,2',5,5'-Tetraphenyl-3,3'-(3,3'-dimethoxy-4,4'-diphenylene)ditetrazoliumchloride;2,2'-(m,m'-Dimethoxy-p,p'-biphenylene)bis(3,5-diphenyltetrazoliumchloride);3,3'-(3,3'-Dimethoxy-4,4'-biphenylene)bis[2,5-diphenyl-2H-tetrazoliumchloride];3,3'-Dianisolebis[4,4'-(3,5-diphenyl)tetrazolium chloride];BT(dye);Blue tetrazolium;Blue tetrazolium chloride;Ditetrazolium chloride;NSC27623;Tetrazolium blue; |
| CAS: | 1871-22-3 |
| EINECS: | 217-488-8 |
| Molecular Formula: | C40H32Cl2N8O2 |
| Molecular Weight: | 731.67224 |
| InChI: | InChI=1S/C40H34N8O2.2ClH/c1-49-37-27-31(23-25-35(37)47-43-39(29-15-7-3-8-16-29)41-45(47)33-19-11-5-12-20-33)32-24-26-36(38(28-32)50-2)48-44-40(30-17-9-4-10-18-30)42-46(48)34-21-13-6-14-22-34;;/h3-28H,1-2H3,(H,41,43)(H,42,44);2*1H |
| Molecular Structure: |
![(C40H32Cl2N8O2) 2H-Tetrazolium,2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3,5-diphenyl-, dichloride(9CI);2H-T...](https://img.guidechem.com/casimg/1871-22-3.gif) |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility: | slight Stability Stable, but may be light sensitive. Incompatible withstrong oxidizing agents. Toxicology Harmful, and may be toxic, if swallowed. Toxicity data |
| Solubility: | slight |
| Appearance: | yellow crystalline solid |
| HS Code: | 29339990 |
| Flash Point: | °C |
| Storage Temperature: | Store in a cool, dry, well-ventilated area away from incompatible substances. Keep containers tightly closed. |
| Usage: | For research in seed germination, as stain for bacteria and molds, in histochemical studies, to demonstrate oxidation-reduction enzymes in normal and cancerous tissues. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |