| Identification | |
| Name: | Acetic acid,2-(4-methoxyphenoxy)- |
| Synonyms: | Aceticacid, (4-methoxyphenoxy)- (9CI);Acetic acid, (p-methoxyphenoxy)-(6CI,7CI,8CI);2-(4-Methoxyphenoxy)acetic acid;4-Methoxyphenyloxyacetic acid;NSC 4255;NSC 45652;p-Methoxyphenoxyacetic acid; |
| CAS: | 1877-75-4 |
| EINECS: | 217-513-2 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.17 |
| InChI: | InChI=1/C9H10O4/c1-12-7-2-4-8(5-3-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.226 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Solubility: | Very soluble |
| Appearance: | white crystal |
| Specification: |
4-Methoxyphenoxyacetic acid , its CAS NO. is 1877-75-4, the synonyms are 2-(4-Methoxyphenoxy)acetic acid ; AI3-10592 ; Acetic acid, (4-methoxyphenoxy)- ; Acetic acid, (p-methoxyphenoxy)- ; EINECS 217-513-2 ; NSC 45652 . |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
