| Identification | |
| Name: | Carbonochloridic acid, phenyl ester |
| Synonyms: | phenyl chloroformate; PHENYL CHLOROFORMATE (PCF) |
| CAS: | 1885-14-9 |
| EINECS: | 217-547-8 |
| Molecular Formula: | C7H5ClO2 |
| Molecular Weight: | 156.57 |
| InChI: | InChI=1/C7H5ClO2/c8-7(9)10-6-4-2-1-3-5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2746 |
| Density: | 1.248 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | 1.51-1.512 |
| Water Solubility: | hydrolysis |
| Solubility: | Decomposes |
| Appearance: | clear to yellow liquid |
| Packinggroup: | II |
| HS Code: | 29159020 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Moisture Sensitive |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
|
 |
|
