| Identification | |
| Name: | 2H-Azepin-2-one,1-acetylhexahydro- |
| Synonyms: | Activator O;Aktivator O;N-Acetyl-6-caprolactam;N-Acetyl-e-caprolactam;NSC 522408;1-Acetylhexahydro-2H-azepin-2-one;1-Acetylhexahydroazepin-2-one;1-Acetylperhydro-2-azepinone;Acetylcaprolactam; |
| CAS: | 1888-91-1 |
| EINECS: | 217-565-6 |
| Molecular Formula: | C8H13NO2 |
| Molecular Weight: | 155.19 |
| InChI: | InChI=1/C8H13NO2/c1-7(10)9-6-4-2-3-5-8(9)11/h2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.489(lit.) |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May act as a skin, eye or respiratory irritant. Toxicity data (The meaning of any toxico |
| Solubility: |
|
| Appearance: | colourless liquid |
| Specification: |
N-Acetylcaprolactam (1888-91-1) also can be called Acetylcaprolactam ; 1-Acetylazepan-2-one ; 2H-azepin-2-one, 1-acetylhexahydro- ; 1-Acetyl-hexahydro-2H-azepin-2-one and 1-Acetyl-2-azepanone . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
