| Identification | |
| Name: | 2-Propenoic acid,2-methyl-, 2-chloroethyl ester |
| Synonyms: | Methacrylicacid, 2-chloroethyl ester (6CI,7CI,8CI); Ethanol, 2-chloro-, methacrylate(8CI); 2-Chloroethyl methacrylate; Methacrylic acid b-chloroethyl ester; NSC 18595; b-Chloroethyl methacrylate |
| CAS: | 1888-94-4 |
| EINECS: | 217-566-1 |
| Molecular Formula: | C6H9ClO2 |
| Molecular Weight: | 148.58 |
| InChI: | InChI=1/C6H9ClO2/c1-5(2)6(8)9-4-3-7/h1,3-4H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Flash Point: | 75.3°C |
| Density: | 59 |
| Refractive index: | 1.4510 |
| Specification: |
Chloroethyl methacrylate with cas registry number of 1888-94-4 is also known as 2-Chloroethyl methacrylate ; 2-Propenoic acid, 2-methyl-, 2-chloroethyl ester ; 3-02-00-01285 (Beilstein Handbook Reference) ; Methacrylic acid beta-chloroethyl ester ; Methacrylic acid, 2-chloroethyl ester ; NSC 18595 . |
| Packinggroup: | III |
| Flash Point: | 75.3°C |
| Safety Data | |
 |
|
