| Identification | |
| Name: | Hydrazinecarboximidamide,2-[(5-methoxy-1H-indol-3-yl)methylene]-N-pentyl- |
| Synonyms: | (2E)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-N-pentylhydrazinecarboximidamide (2Z)-but-2-enedioate (1:1);hydrazinecarboximidamide, 2-[(5-methoxy-1H-indol-3-yl)methylene]-N-pentyl-, (2E)-, (2Z)-2-butenedioate (1:1);Tegaserod; |
| CAS: | 189188-57-6 |
| Molecular Formula: | C16H23N5O.C4H4O4 |
| Molecular Weight: | 417.45888 |
| InChI: | InChI=1S/C16H23N5O.C4H4O4/c1-3-4-5-8-18-16(17)21-20-11-12-10-19-15-7-6-13(22-2)9-14(12)15;5-3(6)1-2-4(7)8/h6-7,9-11,20H,3-5,8H2,1-2H3,(H3,17,18,21);1-2H,(H,5,6)(H,7,8)/b12-11+;2-1- |
| Molecular Structure: | ![(C16H23N5O.C4H4O4) (2E)-2-[(5-methoxy-1H-indol-3-yl)methylidene]-N-pentylhydrazinecarboximidamide (2Z)-but-2-enedioate ...](https://img.guidechem.com/structure/189188-57-6.gif) |
| Properties | |
| Flash Point: | 353.8°C |
| Boiling Point: | 661.4°C at 760 mmHg |
| Water Solubility: | Practically insoluble |
| Appearance: | white powder |
| Flash Point: | 353.8°C |
| Usage: | A gastroproeinetic used in the treatment of irritable bowel syndrome. A selective serotonin 5HT4-receptor partial agonist |
| Safety Data | |
 |
|
