| Identification | |
| Name: | 4(3H)-Quinazolinone,3-(4-ethoxyphenyl)-2-methyl- |
| Synonyms: | 4(3H)-Quinazolinone,3-(p-ethoxyphenyl)-2-methyl- (6CI,7CI,8CI);2-Methyl-3-(p-ethoxyphenyl)-4-quinazolone; 2-Methyl-3-(p-ethoxyphenyl)quinazolin-4-one;2-Methyl-3-(p-phenethyl)-4-quinazolone; Lonethyl; Lonetil |
| CAS: | 1897-96-7 |
| Molecular Formula: | C17H16 N2 O2 |
| Molecular Weight: | 280.35 |
| InChI: | InChI=1/C17H16N2O2/c1-3-21-14-10-8-13(9-11-14)19-12(2)18-16-7-5-4-6-15(16)17(19)20/h4-11H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 230.9°C |
| Boiling Point: | 458.1°Cat760mmHg |
| Density: | 1.17g/cm3 |
| Refractive index: | 1.605 |
| Specification: |
Lonetil M3 ,its cas register number is 1897-96-7. It also can be called 4(3H)-Quinazolinone, 3-(p-ethoxyphenyl)-2-methyl- ; 2-Methyl-3-(4'-aethoxyphenyl)chinazolinone(4) ; and Lonetil . |
| Flash Point: | 230.9°C |
| Safety Data | |
 |
|
