| Identification | |
| Name: | Phenol, 4-(hexyloxy)- |
| Synonyms: | Phenol,p-(hexyloxy)- (6CI,7CI,8CI); 4-(Hexyloxy)phenol; 4-n-Hexoxyphenol;4-n-Hexyloxyphenol; p-(Hexyloxy)phenol; p-Hexoxyphenol |
| CAS: | 18979-55-0 |
| EINECS: | 242-713-1 |
| Molecular Formula: | C12H18 O2 |
| Molecular Weight: | 194.27 |
| InChI: | InChI=1/C12H18O2/c1-2-3-4-5-10-14-12-8-6-11(13)7-9-12/h6-9,13H,2-5,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.9°C |
| Boiling Point: | 112 °C / 3mmHg |
| Density: | 0.999g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.508 |
| Appearance: | Slightly brown solid. |
| Specification: |
4-Hexyloxyphenol with cas registry number of 18979-55-0 is also called Phenol, 4-(hexyloxy)- . It can be used as intermediate of Liquid Crystals. |
| Flash Point: | 140.9°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
