| Identification |
| Name: | Pyrido[2,3-d]pyrimidin-2(1H)-one,4-(3-chlorophenyl)-1,7-diethyl- |
| Synonyms: | YM 976 |
| CAS: | 191219-80-4 |
| Molecular Formula: | C17H16 Cl N3 O |
| Molecular Weight: | 313.78 |
| InChI: | InChI=1/C17H16ClN3O/c1-3-13-8-9-14-15(11-6-5-7-12(18)10-11)20-17(22)21(4-2)16(14)19-13/h5-10H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 132.7-134.0 °C(lit.)
|
| Flash Point: | 247.4°C |
| Boiling Point: | 485.4°Cat760mmHg |
| Density: | 1.27g/cm3 |
| Refractive index: | 1.638 |
| Biological Activity: | Orally active PDE4 inhibitor (IC 50 = 2.2 nM). Low emetogenic activity, suggested to be due to poor brain penetration. |
| Flash Point: | 247.4°C |
| Storage Temperature: | 2-8°C |
| Color: | pale yellow |
| Safety Data |
| |
 |
