| Identification | |
| Name: | alpha-Phenylpiperidine-2-acetamide |
| Synonyms: | 2-Phenyl-2-(2-piperidyl)acetamide;erythro/threo-2-Phenyl-2-piperidin-2-ylacetamide;2-Piperidineacetamide, a-phenyl-; |
| CAS: | 19395-39-2 |
| EINECS: | 243-019-1 |
| Molecular Formula: | C13H18N2O |
| Molecular Weight: | 218.29 |
| InChI: | InChI=1/C13H18N2O/c14-13(16)12(10-6-2-1-3-7-10)11-8-4-5-9-15-11/h1-3,6-7,11-12,15H,4-5,8-9H2,(H2,14,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 199.7 °C |
| Boiling Point: | 406.6 °C at 760 mmHg |
| Density: | 1.097 g/cm3 |
| Refractive index: | 1.554 |
| Appearance: | White solid |
| Specification: |
alpha-Phenylpiperidine-2-acetamide , its cas register number is 19395-39-2. It also can be called 2-Piperidineacetamide, a-phenyl- ; 2-Phenyl-2-piperidin-2-ylacetamide .It is a white solid. |
| Flash Point: | 199.7 °C |
| Usage: |
alpha-Phenylpiperidine-2-acetamide (CAS NO.19395-39-2) can be intermediate use for the synthesis of Ritalinic Acid. |
| Safety Data | |
 |
|
