Identification |
Name: | Hydrazine,(2-ethylphenyl)-, hydrochloride (1:1) |
Synonyms: | Hydrazine,(2-ethylphenyl)-, monohydrochloride (9CI); Hydrazine, (o-ethylphenyl)-,hydrochloride (6CI); Hydrazine, (o-ethylphenyl)-, monohydrochloride (8CI) |
CAS: | 19398-06-2 |
EINECS: | 421-460-2 |
Molecular Formula: | C8H12 N2 . Cl H |
Molecular Weight: | 172.65522 |
InChI: | InChI=1S/C8H12N2/c1-2-7-5-3-4-6-8(7)10-9/h3-6,10H,2,9H2,1H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3077 |
Melting Point: | 178 ºC (dec.) |
Density: | g/cm3 |
Appearance: | almost white to beige fluffy powder |
Safety Data |
Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
|
 |