| Identification | |
| Name: | Benzeneacetic acid,4-hydroxy-3,5-diiodo- |
| Synonyms: | Aceticacid, (4-hydroxy-3,5-diiodophenyl)- (6CI,7CI,8CI);3,5-Diiodo-4-hydroxyphenylacetic acid;4-Hydroxy-3,5-diiodophenylacetic acid;a-(3,5-Diiodo-4-hydroxyphenyl)aceticacid; |
| CAS: | 1948-39-6 |
| EINECS: | 217-753-8 |
| Molecular Formula: | C8H6I2O3 |
| Molecular Weight: | 403.9404 |
| InChI: | InChI=1/C8H6I2O3/c9-5-1-4(3-7(11)12)2-6(10)8(5)13/h1-2,13H,3H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.533 g/cm3 |
| Refractive index: | 1.751 |
| Specification: |
The 4-Hydroxy-3,5-diiodophenylacetic acid, with the CAS registry number 1948-39-6 and EINECS registry number 217-753-8, has the systematic name of (4-hydroxy-3,5-diiodophenyl)acetic acid. And the molecular formula of the chemical is C8H6I2O3. The characteristics of this chemical are as followings: (1)ACD/LogP: 2.65; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.28; (4)ACD/LogD (pH 7.4): -0.81; (5)ACD/BCF (pH 5.5): 2.59; (6)ACD/BCF (pH 7.4): 1; (7)ACD/KOC (pH 5.5): 28.13; (8)ACD/KOC (pH 7.4): 1; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 35.53 Å2; (13)Index of Refraction: 1.751; (14)Molar Refractivity: 65.06 cm3; (15)Molar Volume: 159.4 cm3; (16)Polarizability: 25.79×10-24cm3; (17)Surface Tension: 76.7 dyne/cm; (18)Density: 2.533 g/cm3; (19)Flash Point: 177.8 °C; (20)Enthalpy of Vaporization: 65.11 kJ/mol; (21)Boiling Point: 370.3 °C at 760 mmHg; (22)Vapour Pressure: 3.87E-06 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
