| Identification | |
| Name: | Carbamic acid,N-(3-chlorophenyl)-, 1-methyl-2-propyn-1-yl ester |
| Synonyms: | Carbamicacid, (3-chlorophenyl)-, 1-methyl-2-propynyl ester (9CI); Carbanilic acid,m-chloro-, 1-methyl-2-propynyl ester (6CI,8CI); 1-Butyn-3-ylm-chlorophenylcarbamate; 3-Butyn-2-yl m-chlorocarbanilate;3-Chlorophenylcarbamic acid 1-methylpropynyl ester; BIPC; Chlorbufam;Chlorbupham; Chlorobufam; Grisemin |
| CAS: | 1967-16-4 |
| EINECS: | 217-815-4 |
| Molecular Formula: | C11H10 Cl N O2 |
| Molecular Weight: | 223.67 |
| InChI: | InChI=1/C11H10ClNO2/c1-3-8(2)15-11(14)13-10-6-4-5-9(12)7-10/h1,4-8H,2H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Flash Point: | 117.1°C |
| Boiling Point: | 270°Cat760mmHg |
| Density: | 1.281g/cm3 |
| Refractive index: | 1.589 |
| Solubility: | Solubility at 20 deg C - methanol (286 g/Kg); acetone (280 g/Kg); ethanol (95 g/Kg) In water, 540 mg/L at 20 deg C |
| Specification: |
m-Chlorophenylcarbamic acid-1-methyl-2-propynyl ester , its cas register number is 1967-16-4. It also can be called (3-Chlorophenyl)-carbamicaci1-methyl-2-propynylester ; 1-Butyn-3-yl-m-Chlorophenylcarbamate ; 1-butyn-3-ylm-Chlorophenylcarbamate ; 1-Methyl-2-propynylm-chlorocarbanilate ; Chlorbupham ; 1-Methylprop-2-ynyl3-chlorocarbanilate ; 1-Methylpropynyl3-chlorophenylcarbamate ; 3-Chlorphenyl-carbamidsaure-butin-(1)-yl(3)-ester ; Carbamic acid, (3-chlorophenyl)-, 1-methyl-2-propynyl ester ; and 1-methylpropynylester of 3-chlorophenylcarbamic acid . Its classification code are Agricultural Chemical; Drug / Therapeutic Agent; Herbicide and Natural Product. |
| Flash Point: | 117.1°C |
| Storage Temperature: | 0-6°C |
| Color: | Colorless crystals |
| Safety Data | |
| Hazard Symbols |
N: Dangerous for the environment
|
 |
|
