| Identification | |
| Name: | 2-Propanol, 1-bromo- |
| CAS: | 19686-73-8 |
| EINECS: | 243-225-1 |
| Molecular Formula: | C3H7 Br O |
| Molecular Weight: | 138.99 |
| InChI: | InChI=1S/C3H7BrO/c1-3(5)2-4/h3,5H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 8/PG 2 |
| Flash Point: | 54.4°C |
| Boiling Point: | 144.8°Cat760mmHg |
| Density: | 1.559g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. May be light sensitive. |
| Refractive index: | n20/D 1.480(lit.) |
| Packinggroup: | III |
| Flash Point: | 54.4°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
