| Identification |
| Name: | o-Bromoethylbenzene |
| Synonyms: | 1-Bromo-2-ethylbenzene; Bromoathylbenzene; 2-Ethylbromobenzene |
| CAS: | 1973-22-4 |
| EINECS: | 217-823-8 |
| Molecular Formula: | C8H9Br |
| Molecular Weight: | 185.06 |
| InChI: | InChI=1/C8H9Br/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Density: | 1.338 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.547-1.549 |
| Solubility: | Insoluble |
| Appearance: | Clear colourless to light yellow liquid |
| HS Code: | 29036990 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
N:Dangerousfortheenvironment
|
| |
 |
