| Identification | |
| Name: | 6-Benzothiazolecarbonitrile,2-amino- |
| Synonyms: | 2-Amino-6-cyanobenzothiazole;2-Aminobenzothiazole-6-carbonitrile |
| CAS: | 19759-66-1 |
| Molecular Formula: | C8H5 N3 S |
| Molecular Weight: | 175.21 |
| InChI: | InChI=1/C8H5N3S/c9-4-5-1-2-6-7(3-5)12-8(10)11-6/h1-3H,(H2,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 195.525°C |
| Boiling Point: | 399.69°C at 760 mmHg |
| Density: | 1.452g/cm3 |
| Refractive index: | 1.736 |
| Specification: |
The extinguishing agent of 2-Amino-benzothiazole-6-carbonitrile (CAS No.19759-66-1) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 195.525°C |
| Safety Data | |
 |
|
