| Identification |
| Name: | Benzenamine,2-fluoro-3-methyl- |
| Synonyms: | m-Toluidine,2-fluoro- (6CI,8CI); |
| CAS: | 1978-33-2 |
| Molecular Formula: | C7H8FN |
| Molecular Weight: | 125.14 |
| InChI: | InChI=1/C7H8FN/c1-5-3-2-4-6(9)7(5)8/h2-4H,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2810 |
| Flash Point: | 62.9°C |
| Boiling Point: | 180.3°Cat760mmHg |
| Density: | 1.106g/cm3 |
| Refractive index: | 1.542 |
| Flash Point: | 62.9°C |
| Safety Data |
| Hazard Symbols |
|
| |
 |