| Identification | |
| Name: | Benzene,1-isocyano-4-nitro- |
| Synonyms: | Phenylisocyanide, p-nitro- (6CI,7CI,8CI); 1-Isocyano-4-nitrobenzene; 4-Nitrophenylisocyanide; p-Nitrophenyl isocyanide; p-Nitrophenyl isonitrile |
| CAS: | 1984-23-2 |
| Molecular Formula: | C7H4 N2 O2 |
| Molecular Weight: | 148.13 |
| InChI: | InChI=1/C7H4N2O2/c1-8-6-2-4-7(5-3-6)9(10)11/h2-5H |
| Molecular Structure: |  |
| Properties | |
| Specification: |
1-Isocyano-4-nitrobenzene with cas registry number of 1984-23-2 is also known as 1-Isocyano-4-nitrobenzene ; 4-Nitrophenyl isocyanide ; P-Nitrophenyl isocyanide ; P-Nitrophenyl isonitrile ; Benzene,1-isocyano-4-nitro- ; Phenyl isocyanide,p-nitro- (6CI,7CI,8CI) . It an agricultural chemical which should be stored in a cool, dry place . 1-Isocyano-4-nitrobenzene with cas registry number of 1984-23-2 is used as a insecticide. |
| Safety Data | |
| Hazard Symbols | |
 |
|
