Identification |
Name: | Cyclopropanamine,2-phenyl-, hydrochloride (1:1), (1R,2S)-rel- |
Synonyms: | (+)-Tranylcypromine; |
CAS: | 1986-47-6 |
Molecular Formula: | C9H12ClN |
Molecular Weight: | 169.65 |
InChI: | InChI=1/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/p+1/t8-,9+/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | 3249 |
Melting Point: | 162-169 °C(lit.)
|
Flash Point: | 90.8°C |
Boiling Point: | 218.3°Cat760mmHg |
Density: | g/cm3 |
Packinggroup: | III |
Biological Activity: | Irreversible inhibitor of lysine-specific demethylase 1 (LSD1/BHC110) and monoamine oxidase (MAO) (K i values are 242, 102 and 16 μ M for LSD1, MAO-A and MAO-B respectively). Inhibits histone demethylation. |
Flash Point: | 90.8°C |
Storage Temperature: | 2-8°C |
Usage: | Non-selective MAO-A/B inhibitor |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
|