| Identification |
| Name: | m-methoxy phenylacetonitrile |
| Synonyms: | m-Methoxybenzyl cyanide; 3-methoxybenzyl cyanide ; 3-Methoxyphenyl acetonitrile ; (3-Methoxypneny)acetonierile |
| CAS: | 19924-43-7 |
| EINECS: | 243-428-5 |
| Molecular Formula: | C9H9NO |
| Molecular Weight: | 147.18 |
| InChI: | InChI=1/C9H9NO/c1-11-9-4-2-3-8(7-9)5-6-10/h2-4,7H,5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3276 |
| Melting Point: | 8C |
| Density: | 1.054 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5297-1.5317 |
| Water Solubility: | INSOLUBLE |
| Solubility: | Insoluble in water |
| Appearance: | yellow to light yellowLiquid |
| Packinggroup: | III |
| HS Code: | 29269095 |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
