| Identification |
| Name: | 1H-Imidazole-4-propanoicacid, a-amino-2,3-dihydro-2-thioxo-, (aS)- |
| Synonyms: | 2-Sulfanyl-L-histidine; |
| CAS: | 2002-22-4 |
| EINECS: | 217-899-2 |
| Molecular Formula: | C6H9N3O2S |
| Molecular Weight: |
179.15 |
| InChI: | InChI=1/C6H9N3O2S/c7-4(5(10)11)1-3-2-8-6(12)9-3/h2,4H,1,7H2,(H,10,11)(H2,8,9,12)/t4-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 181.4°C |
| Boiling Point: | 376.3°Cat760mmHg |
| Density: | 1.52g/cm3 |
| Refractive index: | 1.695 |
| Flash Point: | 181.4°C |
| Storage Temperature: | -15°C |
| Usage: | An intermediate in the formation of L-egothioneine, a natural amino acid ubiquitously present in cells and tissues of most plants and mammalian species. In humans, L-ergothioneine is found in red blood cells, liver, kidney, brain, seminal fluid, an |
| Safety Data |
| |
 |
