| Identification | |
| Name: | 9H-Purin-2-amine,6-chloro-9-b-D-ribofuranosyl- |
| Synonyms: | 9H-Purine,2-amino-6-chloro-9-b-D-ribofuranosyl- (6CI,7CI,8CI);2-Amino-6-chloro-9-b-D-ribofuranosylpurine;2-Amino-6-chloropurineribonucleoside;2-Amino-6-chloropurine riboside;6-Chloroguanosine;NSC 44586; |
| CAS: | 2004-07-1 |
| EINECS: | 217-905-3 |
| Molecular Formula: | C10H12ClN5O4 |
| Molecular Weight: | 301.69 |
| InChI: | InChI=1/C10H12ClN5O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | 2.19 g/cm3 |
| Refractive index: | -38 ° (C=0.1, H2O) |
| Solubility: | Appearance:white to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | white to off-white crystalline powder |
| Storage Temperature: | −20°C |
| Usage: | 6-Substituted purines; a novel class of inhibitors of endogenous protein degradation |
| Safety Data | |
| Hazard Symbols | |
 |
|
