| Identification | |
| Name: | Quinoline, 2-bromo- |
| Synonyms: | 2-Bromoquinoline; |
| CAS: | 2005-43-8 |
| Molecular Formula: | C9H6BrN |
| Molecular Weight: | 208.05 |
| InChI: | InChI=1/C9H6BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 48-49 C |
| Flash Point: | 130.7°C |
| Boiling Point: | 292.5°Cat760mmHg |
| Density: | 1.564g/cm3 |
| Refractive index: | 1.673 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 130.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
