| Identification |
| Name: | N-Methylmethanamine 2,4-dichlorophenoxyacetate |
| Synonyms: | U 46D Fluid;Spraygraze;DMA-4 herbicide;Farmco D 50;Aminol (herbicide);2-(2,4-dichlorophenoxy)acetic acid; N-methylmethanamine;Bladex G;Shirweed 500;DMA 4 (pesticide);Phordene;Hormin;Amisol;2,4-D amine;D 50 (pesticide);Weedar 64;Clean Crop 2,4-D Amine 500;Dikamin D;Monosan;Wilbur-Ellis 2,4-D Amine 500;Formula 40;Acetic acid,(2,4-dichlorophenoxy)-,compounds,compd. with N-methylmethanamine (1:1);Weedar 96;Dimethylammonium 2,4-dichlorophenoxyacetate;2,4-D-dimethylammonium;2,4-D Amine salt;2,4D amine salt;2,4-D, Dimethylamine Salt; |
| CAS: | 2008-39-1 |
| EINECS: | 217-915-8 |
| Molecular Formula: | C8H6Cl2O3.C2H7N |
| Molecular Weight: | 266.12 |
| InChI: | InChI=1/C8H6Cl2O3.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-3-2/h1-3H,4H2,(H,11,12);3H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3345 |
| Melting Point: | 92.8 - 93.4 |
| Stability: | Most amine formulations have no shelf life limitations and are insensitive to light and temperature. |
| Solubility: | 300 g/100 g of @ 20 C |
| Appearance: | Brown liquid. |
| Packinggroup: | III |
| Storage Temperature: | Store at ambient temperatures with open venting. |
| Color: | White crystals |
| Usage: | Herbicide for broadleaf weeds & brush on small grains, corn, sorghum, sugarcane, rice, minor crops, grazing land, turf, non-cropland. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
