| Identification | ||
| Name: | Benzenepropanoic acid,ethyl ester | |
| Synonyms: | Hydrocinnamicacid, ethyl ester (6CI,8CI);3-Phenylpropanoic acid ethyl ester;3-Phenylpropionic acid ethyl ester;Ethyl 3-phenylpropanoate;Ethyl benzenepropanoate;Ethyl dihydrocinnamate;Ethylhydrocinnamate;NSC 126040; | |
| CAS: | 2021-28-5 | |
| EINECS: | 217-966-6 | |
| Molecular Formula: | C11H14O2 | |
| Molecular Weight: | 178.23 | |
| InChI: | InChI=1/C11H14O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.1 | |
| Stability: | No data. | |
| Refractive index: | 1.494-1.496 | |
| Water Solubility: | <0.1 g/100 mL at 25 ºC | |
| Solubility: | <0.1 g/100 mL at 25 ºC in water | |
| Appearance: | colorless liquid | |
| Specification: | clear colorless to light yellow liquid Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes | |
| HS Code: | 29163900 | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Safety Data | ||
 |
||
