| Identification |
| Name: | Butanamide,N-methyl-3-oxo- |
| Synonyms: | Acetoacetamide,N-methyl- (8CI);2-Acetyl-N-methylacetamide;N-Methyl-3-oxobutanamide;N-Methylacetoacetamide; |
| CAS: | 20306-75-6 |
| EINECS: | 243-723-9 |
| Molecular Formula: | C5H9NO2 |
| Molecular Weight: | 115.13 |
| InChI: | InChI=1/C5H9NO2/c1-4(7)3-5(8)6-2/h3H2,1-2H3,(H,6,8) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -3 oC |
| Flash Point: | 105 oC |
| Density: | 1.069 |
| Refractive index: | 1.4325-1.4345 |
| Water Solubility: | hydrolysis |
| Solubility: | hydrolysis |
| Appearance: | Colourless to yellowish clear liquid |
| Flash Point: | 105 oC |
| Usage: | N-Methylacetoacetamide (min. 70% in water) (MMAA) is used as intermediate for the manufacture of insecticides, e.g. monocrotophos Product Data Sheet |
| Safety Data |
| |
 |
