| Identification | |
| Name: | Benzene,1-bromo-2-ethenyl- |
| Synonyms: | Styrene,o-bromo- (6CI,7CI,8CI);1-Bromo-2-ethenylbenzene;1-Bromo-2-vinylbenzene;2-Vinylphenyl bromide;o-Bromostyrene;o-Bromovinylbenzene; |
| CAS: | 2039-88-5 |
| EINECS: | 218-027-3 |
| Molecular Formula: | C8H7Br |
| Molecular Weight: | 183.04 |
| InChI: | InChI=1/C8H7Br/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -53oC |
| Density: | 1.46 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.592 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | olorless or light yellow linquid |
| Specification: |
The extinguishing agent of 2-Bromostyrene (CAS No. 2039-88-5) are dry powder, foam, sand, carbon dioxide, water mist. |
| HS Code: | 29036990 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
