| Identification | |
| Name: | 1,4-Benzenediamine,N4,N4-diethyl-2-methyl-, hydrochloride (1:1) |
| Synonyms: | 1,4-Benzenediamine,N4,N4-diethyl-2-methyl-, monohydrochloride (9CI);Toluene-2,5-diamine,N5,N5-diethyl-, monohydrochloride (8CI);2-Amino-5-(diethylamino)toluenemonohydrochloride;4-(Diethylamino)-2-methylaniline monohydrochloride;4-Amino-N,N-diethyl-m-toluidinehydrochloride;CD 2;CD 2 (amine);N',N'-Diethyl-2-methyl-1,4-phenylenediaminemonohydrochloride;PPD 2; |
| CAS: | 2051-79-8 |
| EINECS: | 218-130-3 |
| Molecular Formula: | C11H18N2.HCl |
| Molecular Weight: | 214.74 |
| InChI: | InChI=1/C11H18N2.ClH/c1-4-13(5-2)10-6-7-11(12)9(3)8-10;/h6-8H,4-5,12H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | off white powder |
| Specification: |
4-Amino-3-methyl-N,N-diethylaniline hydrochloride (CAS NO.2051-79-8), its Synonyms are Toluene-2,5-diamine, N(sup 5),N(sup 5)-diethyl-, monohydrochloride ; 1,4-Benzenediamine, N(sup 4),N(sup 4)-diethyl-2-methyl-, monohydrochloride ; 2-Amino-5-diethylaminotoluene monohydrochloride ; 1,4-Benzenediamine, N4,N4-diethyl-2-methyl-, hydrochloride (1:1) ; N5,N5-Diethyltoluene-2,5-diamine monohydrochloride ; p-Phenylenediamine, N,N-diethyl-3-methyl-, hydrochloride ; CD-2 . It is white to grey white crystal. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
