| Identification | |
| Name: | D-Glucurono-6,3-lactone acetonide |
| CAS: | 20513-98-8 |
| EINECS: | -0 |
| Molecular Formula: | C9H12O6 |
| Molecular Weight: | 216.19 |
| InChI: | InChI=1/C9H12O6/c1-9(2)14-6-5-4(13-8(6)15-9)3(10)7(11)12-5/h3-6,8,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 158.8°C |
| Boiling Point: | 386°C at 760 mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.51 |
| Specification: |
The D-Glucurono-6,3-lactone acetonide with the cas number 20513-98-8, is also called a-D-Glucofuranuronic acid, 1,2-O-(1-methylethylidene)-, g-lactone .This chemical belongs to the following product categories:(1)Chiral Reagents; (2)Biochemistry; (3)Glucose; (4)Sugar Acids; (5)Sugars; (6)Carbohydrates & Derivatives; (7)Heterocycles. This product can be supplied by the following suppliers: (1)A Meryer Chemical Technology Shanghai Company; (2)3B Pharmachem International (Wuhan) Co.,Ltd. ; (3)Alfa Aesar ; (4)TCI (Shanghai) Development Co., Ltd. ; (5)Energy Chemical; (6)Wuhan Chemwish Technology Co., Ltd.; (7)Capot Chemical Co., Ltd.; (8)Shanghai Sinch Parmaceuticals Tech. Co. Ltd.; (9)Shanghai PI Chemicals Ltd. ; (10)Nanjing Chemlin Chemical Co., Ltd..
|
| Flash Point: | 158.8°C |
| Safety Data | |
 |
|
