| Identification | |
| Name: | Asparagine D-form |
| Synonyms: | Asparagine,D- (8CI);D-Asparagine; |
| CAS: | 2058-58-4 |
| EINECS: | 218-163-3 |
| Molecular Formula: | C4H8N2O3 |
| Molecular Weight: | 150.13 |
| InChI: | InChI=1/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 218.7 ºC |
| Boiling Point: | 438 ºC at 760 mmHg |
| Density: | 1.404g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -35 º (C=5, 5M HCL) |
| Solubility: | Practically insoluble in methanol, ethanol, ether, benzene. Soluble in acids and alkalies In water, 2.94X10+4 mg/L at 25 deg C |
| Appearance: | White powder |
| Specification: |
Asparagine D-form (CAS NO.2058-58-4), its Synonyms are D(-)-Asparagine monohydrate ; (R)-2-Aminosuccinamic acid ; D-2-Aminosuccinamic acid . |
| Flash Point: | 218.7 ºC |
| Color: | Orthorhombic bisphenoidal crystals |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
