Identification |
Name: | decanoic acid, compound with morpholine (1:1) |
Synonyms: | Decanoic acid, compd. with morpholine (1:1);Capric acid, morpholine salt;Decanoic acid, compound with morpholine (1:1);decanoic acid - morpholine (1:1) |
CAS: | 20599-77-3 |
EINECS: | 243-906-3 |
Molecular Formula: | C14H29NO3 |
Molecular Weight: | 259.385 |
InChI: | InChI=1/C10H20O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-6-4-2-5-1/h2-9H2,1H3,(H,11,12);5H,1-4H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 121.8°C |
Boiling Point: | 269.6°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 121.8°C |
Safety Data |
|
 |