| Identification | ||
| Name: | Phosphonium,methyltriphenyl-, iodide (1:1) | |
| Synonyms: | Methyltriphenylphosphoniumiodide (6CI,7CI); Phosphonium, methyltriphenyl-, iodide (8CI,9CI);Triphenylmethylphosphinium iodide; Triphenylmethylphosphonium iodide | |
| CAS: | 2065-66-9 | |
| EINECS: | 218-178-5 | |
| Molecular Formula: | C19H18 P . I | |
| Molecular Weight: | 404.23 | |
| InChI: | InChI=1/C18H15P.CH3I/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2/h1-15H;1H3/p+1 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | HAZARD | |
| Melting Point: | 183 - 188 C (Decomposes) | |
| Flash Point: | 235 | |
| Stability: | Stable under normal temperatures and pressures. | |
| Water Solubility: | SOLUBLE | |
| Solubility: | Soluble | |
| Appearance: | white to yellowish crystalline powder | |
| Specification: |
Methyltriphenylphosphonium iodide , with CAS number of 2065-66-9, can be called phosphonium, methyltriphenyl-, iodide (1:1) ; Triphenylmethylphosphinium iodide ; Triphenylmethylphosphonium iodide . It is a white to light yellow powder. | |
| Packinggroup: | III | |
| Flash Point: | 235 | |
| Storage Temperature: | Store in a cool, dry place. Do not store in direct sunlight. Store in a tightly closed container. | |
| Sensitive: | Light Sensitive & Hygroscopic | |
| Safety Data | ||
| Hazard Symbols |
T: Toxic
|
|
 |
||
