| Identification |
| Name: | Benzoic acid, 4-butyl- |
| Synonyms: | Benzoicacid, p-butyl- (6CI,8CI);4-n-Butylbenzoic acid;p-Butylbenzoic acid;p-n-Butylbenzoic acid; |
| CAS: | 20651-71-2 |
| EINECS: | 243-940-9 |
| Molecular Formula: | C11H14O2 |
| Molecular Weight: | 178.23 |
| InChI: | InChI=1/C11H14O2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8H,2-4H2,1H3,(H,12,13) |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 313 |
| Density: | 1.062 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Slightly soluble |
| Appearance: | White crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
