| Identification | |
| Name: | 1,8-Naphthalenediamine,N1,N1,N8,N8-tetramethyl- |
| Synonyms: | 1,8-Naphthalenediamine,N,N,N',N'-tetramethyl- (8CI,9CI);1,8-Bis-(Dimethylamino)naphthaline;N,N,N',N'-Tetramethyl-1,8-diaminonaphthalene;N,N,N',N'-Tetramethyl-1,8-naphthalenediamine;Proton sponge; |
| CAS: | 20734-58-1 |
| EINECS: | 244-001-6 |
| Molecular Formula: | C14H18N2 |
| Molecular Weight: | 214.31 |
| InChI: | InChI=1/C14H18N2/c1-15(2)12-9-5-7-11-8-6-10-13(14(11)12)16(3)4/h5-10H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.074 g/cm3 |
| Refractive index: | 1.649 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | pinkish white crystal |
| Specification: |
1,8-Naphthalenediamine,N1,N1,N8,N8-tetramethyl- , its cas register number is 20734-58-1. It also can be called AI3-62472 ; EINECS 244-001-6 ; N,N,N',N'-Tetramethylnaphthalene-1,8-diamine . 1,8-Naphthalenediamine,N1,N1,N8,N8-tetramethyl- (CAS NO.20734-58-1) is harmful if swallowed. And it's irritating to eyes, respiratory system and skin. |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
