| Identification | |
| Name: | L-Phenylalanine,4-nitro-, hydrate (1:1) |
| CAS: | 207591-86-4 |
| EINECS: | 220-868-6 |
| Molecular Formula: | C9H12N2O5 |
| Molecular Weight: | 228.20 g/mol |
| InChI: | InChI=1/C9H10N2O4.H2O/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15;/h1-4,8H,5,10H2,(H,12,13);1H2/t8-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 |
| Melting Point: | 230 oC |
| Flash Point: | 253.5 oC |
| Boiling Point: | 495.6 oC at 760 mmHg |
| Density: | 1.408 g/cm3 |
| Appearance: | white crystalline powder |
| Specification: |
4-Nitro-l-Phenylalanine Monohydrate, its cas register number is 207591-86-4. It also can be called 4-Nitro-D-phenylalanine hydrate ; (S)-4-Nitrophenylalanine monohydrate ; and D-phenylalanine, 4-nitro-, hydrate . 4-Nitro-l-Phenylalanine Monohydrate (CAS NO.207591-86-4) should avoid the condition of incompatible materials and excess heat. It is not compatible with strong oxidizing agents. And its hazardous decomposition products are carbon monoxide, oxides of nitrogen, carbon dioxide. And its hazardous polymerization has not been reported. |
| Packinggroup: | III |
| Flash Point: | 253.5 oC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
