| Identification | |
| Name: | 2-Amino-6-bromobenzoic acid |
| Synonyms: | Anthranilicacid, 6-bromo- (6CI,8CI);3-Bromo-2-carboxyaniline;6-Bromoanthranilic acid; |
| CAS: | 20776-48-1 |
| EINECS: | 227-338-3 |
| Molecular Formula: | C7H6BrNO2 |
| Molecular Weight: | 216.03 |
| InChI: | InChI=1/C7H6BrNO2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.793 g/cm3 |
| Refractive index: | 1.672 |
| Specification: |
2-Amino-6-bromobenzoic acid , with CAS number of 20776-48-1, can be called benzoic acid, 2-amino-6-bromo- ; 3-Bromo-2-carboxyaniline ; 6-Bromoanthranilic acid . 2-Amino-6-bromobenzoic acid (CAS NO.20776-48-1) occurs nucleophilic substitution and is used as material in synthetic lipid, it can be used in synthetic lipid. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
