| Identification | |
| Name: | Disoprofol |
| Synonyms: | diprivan; 2,6-Diisopropylphenol; propofol |
| CAS: | 2078-54-8 |
| EINECS: | 218-206-6 |
| Molecular Formula: | C12H18O |
| Molecular Weight: | 178.27 |
| InChI: | InChI=1/C12H18O/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9,13H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Flash Point: | 107.5 oC |
| Density: | 0.962 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.513-1.515 |
| Water Solubility: | 124 mg/L at 25 ºC in water |
| Solubility: | 124 mg/L at 25 oC in water |
| Appearance: | light yellow liquid |
| Specification: |
?Propofol (CAS NO.2078-54-8), its Synonyms are Disoprofol ; Phenol, 2,6-bis(1-methylethyl)- ; Phenol, 2,6-diisopropyl- ; 2,6-Bis(1-methylethyl)phenol ; 2,6-Diisopropylphenol ; Ampofol ; Aquafo ; Diprivan Injectable emulsion ; Propofol-lipuro ; Propofolum and so on. It is light yellow liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Biological Activity: | Intravenous general anesthetic and hypnotic with a mode of action which includes potentiation of GABA-mediated inhibitory synaptic transmission, direct activation of the GABA A receptor and inhibition of glutamate receptor mediated excitatory synaptic transmission. Also potentiates P2X 4 receptor-mediated currents in P2X 4 -HEK293 cells. |
| Flash Point: | 107.5 oC |
| Color: | Light-straw-colored liquid |
| Usage: | A anesthetic used in veterinary medicine |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
