| Identification | |
| Name: | 2-Propenoic acid,3-(4-chloro-3-nitrophenyl)- |
| Synonyms: | Cinnamicacid, 4-chloro-3-nitro- (7CI,8CI); |
| CAS: | 20797-48-2 |
| EINECS: | 200-680-0 |
| Molecular Formula: | C9H6ClNO4 |
| Molecular Weight: | 227.6 |
| InChI: | InChI=1/C9H6ClNO4/c10-7-3-1-6(2-4-9(12)13)5-8(7)11(14)15/h1-5H,(H,12,13)/p-1/b4-2+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.529 g/cm3 |
| Appearance: | Little yellow crystal |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
