| Identification | |
| Name: | Thiophene, tetrahydro-,1,1-dioxide |
| Synonyms: | 1,1-Dioxothiolan;Bondelane A; Bondolane A; Cyclic tetramethylene sulfone; Cyclotetramethylenesulfone; NSC 46443; Sulfolan; Sulfolane; Sulpholane; Tetrahydrothiophene1,1-dioxide; Tetrahydrothiophene S,S-dioxide; Tetrahydrothiophene dioxide;Tetramethylene sulfone; Thiacyclopentane dioxide; Thiolane 1,1-dioxide;Thiophane 1,1-dioxide; Thiophane dioxide |
| CAS: | 208252-54-4 |
| Molecular Formula: | C4H8O2S |
| Molecular Weight: | 120.17 |
| InChI: | InChI=1S/C4H8O2S/c5-7(6)3-1-2-4-7/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 27.4-27.8 deg C |
| Boiling Point: | 285 deg C |
| Solubility: | Partially miscible with octanes, olefins, naphthenes; miscible with water, Acetone, toluene at 30 deg C Freely soluble in alcohol, soluble in dilute mineral acids |
| Color: | White or creamy white, crystalline powder |
| Safety Data | |
 |
|
